C13H21NO — CID 115908896
N-[(3-methylfuran-2-yl)methyl]hept-6-en-2-amine (PubChem CID 115908896) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is N-[(3-methylfuran-2-yl)methyl]hept-6-en-2-amine.
| Compound Name | N-[(3-methylfuran-2-yl)methyl]hept-6-en-2-amine |
|---|---|
| PubChem CID | 115908896 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-[(3-methylfuran-2-yl)methyl]hept-6-en-2-amine |
| SMILES | C=CCCCC(C)NCc1occc1C |
| InChI | InChI=1S/C13H21NO/c1-4-5-6-7-12(3)14-10-13-11(2)8-9-15-13/h4,8-9,12,14H,1,5-7,10H2,2-3H3 |
| InChIKey | WPHLPQYVYZGQNH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|