C12H15BrClNO — CID 115909414
[1-[(3-bromo-4-chlorophenyl)methylamino]cyclobutyl]methanol (PubChem CID 115909414) has the molecular formula C12H15BrClNO and a molecular weight of 304.62 g/mol. Its IUPAC name is [1-[(3-bromo-4-chlorophenyl)methylamino]cyclobutyl]methanol.
| Compound Name | [1-[(3-bromo-4-chlorophenyl)methylamino]cyclobutyl]methanol |
|---|---|
| PubChem CID | 115909414 |
| Molecular Formula | C12H15BrClNO |
| Molecular Weight | 304.62 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | [1-[(3-bromo-4-chlorophenyl)methylamino]cyclobutyl]methanol |
| SMILES | OCC1(NCc2ccc(Cl)c(Br)c2)CCC1 |
| InChI | InChI=1S/C12H15BrClNO/c13-10-6-9(2-3-11(10)14)7-15-12(8-16)4-1-5-12/h2-3,6,15-16H,1,4-5,7-8H2 |
| InChIKey | ADIIZBWMUOSSAN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.62 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |