About (Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid
(Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid (PubChem CID 11590972) has the molecular formula C23H17F2NO6S
and a molecular weight of 473.45 g/mol. Its IUPAC name is (Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid |
| PubChem CID | 11590972 |
| Molecular Formula | C23H17F2NO6S |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | (Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid |
| SMILES | CS(=O)(=O)c1ccc(/C(COC(=O)c2cccnc2)=C(/C(=O)O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C23H17F2NO6S/c1-33(30,31)17-7-4-14(5-8-17)18(13-32-23(29)16-3-2-10-26-12-16)21(22(27)28)15-6-9-19(24)20(25)11-15/h2-12H,13H2,1H3,(H,27,28)/b21-18+ |
| InChIKey | XPOORJOQAUCKJE-DYTRJAOYSA-N |
| XLogP | 3.62 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid?
The IUPAC name of (Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid (CID 11590972) is (Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid.
What is the SMILES notation for (Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid?
The canonical SMILES for (Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid is CS(=O)(=O)c1ccc(/C(COC(=O)c2cccnc2)=C(/C(=O)O)c2ccc(F)c(F)c2)cc1.
What is the InChIKey of (Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid?
The InChIKey is XPOORJOQAUCKJE-DYTRJAOYSA-N. The full InChI is InChI=1S/C23H17F2NO6S/c1-33(30,31)17-7-4-14(5-8-17)18(13-32-23(29)16-3-2-10-26-12-16)21(22(27)28)15-6-9-19(24)20(25)11-15/h2-12H,13H2,1H3,(H,27,28)/b21-18+.
What are the key properties of (Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid?
(Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid has a molecular weight of 473.45 g/mol, XLogP of 3.62, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)-4-(pyridine-3-carbonyloxy)but-2-enoic acid is sourced from PubChem (CID 11590972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).