C21H16ClF6NO3 — CID 11591087
2-[4-[[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 11591087) has the molecular formula C21H16ClF6NO3 and a molecular weight of 479.80 g/mol. Its IUPAC name is 2-[4-[[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 11591087 |
| Molecular Formula | C21H16ClF6NO3 |
| Molecular Weight | 479.80 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 2-[4-[[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCc1nc(-c2cccc(Cl)c2)oc1C |
| InChI | InChI=1S/C21H16ClF6NO3/c1-11-8-14(19(30,20(23,24)25)21(26,27)28)6-7-17(11)31-10-16-12(2)32-18(29-16)13-4-3-5-15(22)9-13/h3-9,30H,10H2,1-2H3 |
| InChIKey | YRRJNHABZPGRPK-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.80 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |