C13H9F3N4 — CID 115910965
2-[(3-amino-4-pyridinyl)amino]-5-(trifluoromethyl)benzonitrile (PubChem CID 115910965) has the molecular formula C13H9F3N4 and a molecular weight of 278.24 g/mol. Its IUPAC name is 2-[(3-amino-4-pyridinyl)amino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[(3-amino-4-pyridinyl)amino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 115910965 |
| Molecular Formula | C13H9F3N4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-[(3-amino-4-pyridinyl)amino]-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1Nc1ccncc1N |
| InChI | InChI=1S/C13H9F3N4/c14-13(15,16)9-1-2-11(8(5-9)6-17)20-12-3-4-19-7-10(12)18/h1-5,7H,18H2,(H,19,20) |
| InChIKey | NWLVFQAXRLRXED-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |