About 5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one
5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one (PubChem CID 115911994) has the molecular formula C15H11N3O2S
and a molecular weight of 297.34 g/mol. Its IUPAC name is 5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one.
Molecular Properties
| Compound Name | 5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one |
| PubChem CID | 115911994 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one |
| SMILES | Nc1cccc2oc(Cn3ccc4sccc4c3=O)nc12 |
| InChI | InChI=1S/C15H11N3O2S/c16-10-2-1-3-11-14(10)17-13(20-11)8-18-6-4-12-9(15(18)19)5-7-21-12/h1-7H,8,16H2 |
| InChIKey | GAPQHSAHBQFILZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one?
The IUPAC name of 5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one (CID 115911994) is 5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one.
What is the SMILES notation for 5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one?
The canonical SMILES for 5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one is Nc1cccc2oc(Cn3ccc4sccc4c3=O)nc12.
What is the InChIKey of 5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one?
The InChIKey is GAPQHSAHBQFILZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O2S/c16-10-2-1-3-11-14(10)17-13(20-11)8-18-6-4-12-9(15(18)19)5-7-21-12/h1-7H,8,16H2.
What are the key properties of 5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one?
5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one has a molecular weight of 297.34 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-amino-1,3-benzoxazol-2-yl)methyl]thieno[3,2-c]pyridin-4-one is sourced from PubChem (CID 115911994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).