About [5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol
[5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol (PubChem CID 115912749) has the molecular formula C10H12N2O2S
and a molecular weight of 224.28 g/mol. Its IUPAC name is [5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol |
| PubChem CID | 115912749 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | [5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol |
| SMILES | Cc1cnc(NCc2ccc(CO)o2)s1 |
| InChI | InChI=1S/C10H12N2O2S/c1-7-4-11-10(15-7)12-5-8-2-3-9(6-13)14-8/h2-4,13H,5-6H2,1H3,(H,11,12) |
| InChIKey | AQXKYDTVVZLMLP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol?
The IUPAC name of [5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol (CID 115912749) is [5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol.
What is the SMILES notation for [5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol?
The canonical SMILES for [5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol is Cc1cnc(NCc2ccc(CO)o2)s1.
What is the InChIKey of [5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol?
The InChIKey is AQXKYDTVVZLMLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S/c1-7-4-11-10(15-7)12-5-8-2-3-9(6-13)14-8/h2-4,13H,5-6H2,1H3,(H,11,12).
What are the key properties of [5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol?
[5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol has a molecular weight of 224.28 g/mol, XLogP of 2.15, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]furan-2-yl]methanol is sourced from PubChem (CID 115912749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).