C23H30F3N5O2S — CID 11591372
N-octyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 11591372) has the molecular formula C23H30F3N5O2S and a molecular weight of 497.59 g/mol. Its IUPAC name is N-octyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-octyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 11591372 |
| Molecular Formula | C23H30F3N5O2S |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-octyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCCCCCCCNC(=O)c1nnc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)s1 |
| InChI | InChI=1S/C23H30F3N5O2S/c1-2-3-4-5-6-9-12-27-19(32)20-28-29-22(34-20)31-15-13-30(14-16-31)21(33)17-10-7-8-11-18(17)23(24,25)26/h7-8,10-11H,2-6,9,12-16H2,1H3,(H,27,32) |
| InChIKey | KTQDGVPBQSQLSR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|