C17H19N3O — CID 115913832
1-(4-aminophenyl)-N-(2,6-dimethyl-3-pyridinyl)cyclopropane-1-carboxamide (PubChem CID 115913832) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-(4-aminophenyl)-N-(2,6-dimethyl-3-pyridinyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(4-aminophenyl)-N-(2,6-dimethyl-3-pyridinyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 115913832 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-(4-aminophenyl)-N-(2,6-dimethyl-3-pyridinyl)cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2(c3ccc(N)cc3)CC2)c(C)n1 |
| InChI | InChI=1S/C17H19N3O/c1-11-3-8-15(12(2)19-11)20-16(21)17(9-10-17)13-4-6-14(18)7-5-13/h3-8H,9-10,18H2,1-2H3,(H,20,21) |
| InChIKey | NATXUMARIBPYRZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|