C15H15N5O — CID 115914049
4-[1-[3-(1-methylpyrazol-4-yl)-1,2,4-oxadiazol-5-yl]cyclopropyl]aniline (PubChem CID 115914049) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 4-[1-[3-(1-methylpyrazol-4-yl)-1,2,4-oxadiazol-5-yl]cyclopropyl]aniline.
| Compound Name | 4-[1-[3-(1-methylpyrazol-4-yl)-1,2,4-oxadiazol-5-yl]cyclopropyl]aniline |
|---|---|
| PubChem CID | 115914049 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-[1-[3-(1-methylpyrazol-4-yl)-1,2,4-oxadiazol-5-yl]cyclopropyl]aniline |
| SMILES | Cn1cc(-c2noc(C3(c4ccc(N)cc4)CC3)n2)cn1 |
| InChI | InChI=1S/C15H15N5O/c1-20-9-10(8-17-20)13-18-14(21-19-13)15(6-7-15)11-2-4-12(16)5-3-11/h2-5,8-9H,6-7,16H2,1H3 |
| InChIKey | BRDZCCWCHSVMAT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|