C16H20N4 — CID 115915296
4-N-cyclopentyl-4-N-methyl-2-phenylpyrimidine-4,6-diamine (PubChem CID 115915296) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-N-cyclopentyl-4-N-methyl-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclopentyl-4-N-methyl-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115915296 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 4-N-cyclopentyl-4-N-methyl-2-phenylpyrimidine-4,6-diamine |
| SMILES | CN(c1cc(N)nc(-c2ccccc2)n1)C1CCCC1 |
| InChI | InChI=1S/C16H20N4/c1-20(13-9-5-6-10-13)15-11-14(17)18-16(19-15)12-7-3-2-4-8-12/h2-4,7-8,11,13H,5-6,9-10H2,1H3,(H2,17,18,19) |
| InChIKey | MFYQCQZTJHILBB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |