C16H22N4 — CID 115915312
4-N-butan-2-yl-4-N-ethyl-2-phenylpyrimidine-4,6-diamine (PubChem CID 115915312) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 4-N-butan-2-yl-4-N-ethyl-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-butan-2-yl-4-N-ethyl-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115915312 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 4-N-butan-2-yl-4-N-ethyl-2-phenylpyrimidine-4,6-diamine |
| SMILES | CCC(C)N(CC)c1cc(N)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H22N4/c1-4-12(3)20(5-2)15-11-14(17)18-16(19-15)13-9-7-6-8-10-13/h6-12H,4-5H2,1-3H3,(H2,17,18,19) |
| InChIKey | MJYVANZMSRMARE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |