About 2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine
2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine (PubChem CID 115915426) has the molecular formula C15H18N4S
and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine |
| PubChem CID | 115915426 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine |
| SMILES | Nc1cc(N2CCCSCC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H18N4S/c16-13-11-14(19-7-4-9-20-10-8-19)18-15(17-13)12-5-2-1-3-6-12/h1-3,5-6,11H,4,7-10H2,(H2,16,17,18) |
| InChIKey | NZXOIVDASYWOKJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine?
The IUPAC name of 2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine (CID 115915426) is 2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine.
What is the SMILES notation for 2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine?
The canonical SMILES for 2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine is Nc1cc(N2CCCSCC2)nc(-c2ccccc2)n1.
What is the InChIKey of 2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine?
The InChIKey is NZXOIVDASYWOKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4S/c16-13-11-14(19-7-4-9-20-10-8-19)18-15(17-13)12-5-2-1-3-6-12/h1-3,5-6,11H,4,7-10H2,(H2,16,17,18).
What are the key properties of 2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine?
2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine has a molecular weight of 286.40 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-6-(1,4-thiazepan-4-yl)pyrimidin-4-amine is sourced from PubChem (CID 115915426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).