C16H22N4O — CID 115915730
4-N-(2-ethoxyethyl)-4-N,6-N-dimethyl-2-phenylpyrimidine-4,6-diamine (PubChem CID 115915730) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-N-(2-ethoxyethyl)-4-N,6-N-dimethyl-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-ethoxyethyl)-4-N,6-N-dimethyl-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115915730 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 4-N-(2-ethoxyethyl)-4-N,6-N-dimethyl-2-phenylpyrimidine-4,6-diamine |
| SMILES | CCOCCN(C)c1cc(NC)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H22N4O/c1-4-21-11-10-20(3)15-12-14(17-2)18-16(19-15)13-8-6-5-7-9-13/h5-9,12H,4,10-11H2,1-3H3,(H,17,18,19) |
| InChIKey | JEPULXVYUMBUMK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|