C16H21N3O — CID 115915949
6-(3,3-dimethylbutoxy)-2-phenylpyrimidin-4-amine (PubChem CID 115915949) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 6-(3,3-dimethylbutoxy)-2-phenylpyrimidin-4-amine.
| Compound Name | 6-(3,3-dimethylbutoxy)-2-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115915949 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 6-(3,3-dimethylbutoxy)-2-phenylpyrimidin-4-amine |
| SMILES | CC(C)(C)CCOc1cc(N)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H21N3O/c1-16(2,3)9-10-20-14-11-13(17)18-15(19-14)12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3,(H2,17,18,19) |
| InChIKey | PMSXANQVYHABIQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |