About N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine
N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine (PubChem CID 115916036) has the molecular formula C14H13N5OS
and a molecular weight of 299.36 g/mol. Its IUPAC name is N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine |
| PubChem CID | 115916036 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine |
| SMILES | CNc1cc(Sc2nnc(C)o2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H13N5OS/c1-9-18-19-14(20-9)21-12-8-11(15-2)16-13(17-12)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,15,16,17) |
| InChIKey | KIAYZHSNYFWEFF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine?
The IUPAC name of N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine (CID 115916036) is N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine.
What is the SMILES notation for N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine?
The canonical SMILES for N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine is CNc1cc(Sc2nnc(C)o2)nc(-c2ccccc2)n1.
What is the InChIKey of N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine?
The InChIKey is KIAYZHSNYFWEFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5OS/c1-9-18-19-14(20-9)21-12-8-11(15-2)16-13(17-12)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,15,16,17).
What are the key properties of N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine?
N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine has a molecular weight of 299.36 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-phenylpyrimidin-4-amine is sourced from PubChem (CID 115916036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).