C12H10F2N2O2S — CID 115917312
2,2-difluoro-N-[1-(1,3-thiazol-5-yl)ethyl]-1,3-benzodioxol-5-amine (PubChem CID 115917312) has the molecular formula C12H10F2N2O2S and a molecular weight of 284.29 g/mol. Its IUPAC name is 2,2-difluoro-N-[1-(1,3-thiazol-5-yl)ethyl]-1,3-benzodioxol-5-amine.
| Compound Name | 2,2-difluoro-N-[1-(1,3-thiazol-5-yl)ethyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 115917312 |
| Molecular Formula | C12H10F2N2O2S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2,2-difluoro-N-[1-(1,3-thiazol-5-yl)ethyl]-1,3-benzodioxol-5-amine |
| SMILES | CC(Nc1ccc2c(c1)OC(F)(F)O2)c1cncs1 |
| InChI | InChI=1S/C12H10F2N2O2S/c1-7(11-5-15-6-19-11)16-8-2-3-9-10(4-8)18-12(13,14)17-9/h2-7,16H,1H3 |
| InChIKey | YIDVCMOYIWFCID-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|