C17H19NO2 — CID 115917484
ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate (PubChem CID 115917484) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate.
| Compound Name | ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 115917484 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(-c2cc(C)cc(C)c2)nc1C |
| InChI | InChI=1S/C17H19NO2/c1-5-20-17(19)15-6-7-16(18-13(15)4)14-9-11(2)8-12(3)10-14/h6-10H,5H2,1-4H3 |
| InChIKey | WEZUBONTCPSODP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |