ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate

C17H19NO2 — CID 115917484

IUPACethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate
SMILESCCOC(=O)c1ccc(-c2cc(C)cc(C)c2)nc1C
InChIInChI=1S/C17H19NO2/c1-5-20-17(19)15-6-7-16(18-13(15)4)14-9-11(2)8-12(3)10-14/h6-10H,5H2,1-4H3
InChIKeyWEZUBONTCPSODP-UHFFFAOYSA-N
MW269.34 g/mol
LogP3.85
Rot. Bonds3

About ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate

ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate (PubChem CID 115917484) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate.

Molecular Properties

Compound Nameethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate
PubChem CID115917484
Molecular FormulaC17H19NO2
Molecular Weight269.34 g/mol
Exact Mass269.14
IUPAC Nameethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate
SMILESCCOC(=O)c1ccc(-c2cc(C)cc(C)c2)nc1C
InChIInChI=1S/C17H19NO2/c1-5-20-17(19)15-6-7-16(18-13(15)4)14-9-11(2)8-12(3)10-14/h6-10H,5H2,1-4H3
InChIKeyWEZUBONTCPSODP-UHFFFAOYSA-N
XLogP3.85
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.34
LogP ≤ 53.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate?
The IUPAC name of ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate (CID 115917484) is ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate.
What is the SMILES notation for ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate?
The canonical SMILES for ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate is CCOC(=O)c1ccc(-c2cc(C)cc(C)c2)nc1C.
What is the InChIKey of ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate?
The InChIKey is WEZUBONTCPSODP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-5-20-17(19)15-6-7-16(18-13(15)4)14-9-11(2)8-12(3)10-14/h6-10H,5H2,1-4H3.
What are the key properties of ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate?
ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate has a molecular weight of 269.34 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-(3,5-dimethylphenyl)-2-methylpyridine-3-carboxylate is sourced from PubChem (CID 115917484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).