C12H15N3O5 — CID 115918216
1-(5-methyl-1H-pyrazole-4-carbonyl)piperidine-3,4-dicarboxylic acid (PubChem CID 115918216) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is 1-(5-methyl-1H-pyrazole-4-carbonyl)piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-(5-methyl-1H-pyrazole-4-carbonyl)piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 115918216 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 1-(5-methyl-1H-pyrazole-4-carbonyl)piperidine-3,4-dicarboxylic acid |
| SMILES | Cc1[nH]ncc1C(=O)N1CCC(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C12H15N3O5/c1-6-8(4-13-14-6)10(16)15-3-2-7(11(17)18)9(5-15)12(19)20/h4,7,9H,2-3,5H2,1H3,(H,13,14)(H,17,18)(H,19,20) |
| InChIKey | XCVNYSGFECFYOU-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 123.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |