C14H19NO5 — CID 115918261
1-(2-cyclopent-2-en-1-ylacetyl)piperidine-3,4-dicarboxylic acid (PubChem CID 115918261) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-(2-cyclopent-2-en-1-ylacetyl)piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-(2-cyclopent-2-en-1-ylacetyl)piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 115918261 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-(2-cyclopent-2-en-1-ylacetyl)piperidine-3,4-dicarboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)CC2C=CCC2)CC1C(=O)O |
| InChI | InChI=1S/C14H19NO5/c16-12(7-9-3-1-2-4-9)15-6-5-10(13(17)18)11(8-15)14(19)20/h1,3,9-11H,2,4-8H2,(H,17,18)(H,19,20) |
| InChIKey | FVIBUKCFUVVZPK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|