C13H20N2O6 — CID 115918579
1-(4-methoxypyrrolidine-2-carbonyl)piperidine-3,4-dicarboxylic acid (PubChem CID 115918579) has the molecular formula C13H20N2O6 and a molecular weight of 300.31 g/mol. Its IUPAC name is 1-(4-methoxypyrrolidine-2-carbonyl)piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-(4-methoxypyrrolidine-2-carbonyl)piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 115918579 |
| Molecular Formula | C13H20N2O6 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-(4-methoxypyrrolidine-2-carbonyl)piperidine-3,4-dicarboxylic acid |
| SMILES | COC1CNC(C(=O)N2CCC(C(=O)O)C(C(=O)O)C2)C1 |
| InChI | InChI=1S/C13H20N2O6/c1-21-7-4-10(14-5-7)11(16)15-3-2-8(12(17)18)9(6-15)13(19)20/h7-10,14H,2-6H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | KLRARFXTESHPMO-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |