C34H35NO5 — CID 11591923
ditert-butyl 5'-(2,6-dimethylphenyl)iminospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate (PubChem CID 11591923) has the molecular formula C34H35NO5 and a molecular weight of 537.66 g/mol. Its IUPAC name is ditert-butyl 5'-(2,6-dimethylphenyl)iminospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate.
| Compound Name | ditert-butyl 5'-(2,6-dimethylphenyl)iminospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate |
|---|---|
| PubChem CID | 11591923 |
| Molecular Formula | C34H35NO5 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | ditert-butyl 5'-(2,6-dimethylphenyl)iminospiro[fluorene-9,2'-furan]-3',4'-dicarboxylate |
| SMILES | Cc1cccc(C)c1/N=C1\OC2(C(C(=O)OC(C)(C)C)=C1C(=O)OC(C)(C)C)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C34H35NO5/c1-20-14-13-15-21(2)28(20)35-29-26(30(36)39-32(3,4)5)27(31(37)40-33(6,7)8)34(38-29)24-18-11-9-16-22(24)23-17-10-12-19-25(23)34/h9-19H,1-8H3/b35-29- |
| InChIKey | ZEQLLYXIARWXIL-MJPNWULPSA-N |
| XLogP | 7.27 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|