C13H14F9N5O4S2 — CID 11591945
bis(trifluoromethylsulfonyl)azanide;2-methyl-1-(pyrazol-1-ylmethyl)-3-(3,3,3-trifluoropropyl)imidazol-1-ium (PubChem CID 11591945) has the molecular formula C13H14F9N5O4S2 and a molecular weight of 539.40 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;2-methyl-1-(pyrazol-1-ylmethyl)-3-(3,3,3-trifluoropropyl)imidazol-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;2-methyl-1-(pyrazol-1-ylmethyl)-3-(3,3,3-trifluoropropyl)imidazol-1-ium |
|---|---|
| PubChem CID | 11591945 |
| Molecular Formula | C13H14F9N5O4S2 |
| Molecular Weight | 539.40 g/mol |
| Exact Mass | 539.03 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;2-methyl-1-(pyrazol-1-ylmethyl)-3-(3,3,3-trifluoropropyl)imidazol-1-ium |
| SMILES | Cc1n(CCC(F)(F)F)cc[n+]1Cn1cccn1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H14F3N4.C2F6NO4S2/c1-10-16(6-3-11(12,13)14)7-8-17(10)9-18-5-2-4-15-18;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h2,4-5,7-8H,3,6,9H2,1H3;/q+1;-1 |
| InChIKey | PIKZTHXNIMNXCL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 109.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|