C25H32Cl2N4O3S — CID 11591948
7-[1-ethylsulfonyl-5-[3-(methylamino)propoxy]-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride (PubChem CID 11591948) has the molecular formula C25H32Cl2N4O3S and a molecular weight of 539.53 g/mol. Its IUPAC name is 7-[1-ethylsulfonyl-5-[3-(methylamino)propoxy]-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride.
| Compound Name | 7-[1-ethylsulfonyl-5-[3-(methylamino)propoxy]-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 11591948 |
| Molecular Formula | C25H32Cl2N4O3S |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 7-[1-ethylsulfonyl-5-[3-(methylamino)propoxy]-2,3-dihydroindol-2-yl]naphthalene-2-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc2ccc(C3Cc4cc(OCCCNC)ccc4N3S(=O)(=O)CC)cc2c1 |
| InChI | InChI=1S/C25H30N4O3S.2ClH/c1-3-33(30,31)29-23-10-9-22(32-12-4-11-28-2)15-21(23)16-24(29)18-7-5-17-6-8-19(25(26)27)14-20(17)13-18;;/h5-10,13-15,24,28H,3-4,11-12,16H2,1-2H3,(H3,26,27);2*1H |
| InChIKey | OJXYEWXKZFJVND-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|