C10H18ClNO — CID 115919583
N-(2-chloroprop-2-enyl)-2,6-dimethyloxan-4-amine (PubChem CID 115919583) has the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-2,6-dimethyloxan-4-amine.
| Compound Name | N-(2-chloroprop-2-enyl)-2,6-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 115919583 |
| Molecular Formula | C10H18ClNO |
| Molecular Weight | 203.71 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-2,6-dimethyloxan-4-amine |
| SMILES | C=C(Cl)CNC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C10H18ClNO/c1-7(11)6-12-10-4-8(2)13-9(3)5-10/h8-10,12H,1,4-6H2,2-3H3 |
| InChIKey | BUOBKERZENOXLR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.71 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |