About N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine
N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine (PubChem CID 115922520) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine.
Molecular Properties
| Compound Name | N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine |
| PubChem CID | 115922520 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine |
| SMILES | CCC(C)NC1(C)Cc2ccccc2C1 |
| InChI | InChI=1S/C14H21N/c1-4-11(2)15-14(3)9-12-7-5-6-8-13(12)10-14/h5-8,11,15H,4,9-10H2,1-3H3 |
| InChIKey | GSKBAEKZFNYJIE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine?
The IUPAC name of N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine (CID 115922520) is N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine.
What is the SMILES notation for N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine?
The canonical SMILES for N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine is CCC(C)NC1(C)Cc2ccccc2C1.
What is the InChIKey of N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine?
The InChIKey is GSKBAEKZFNYJIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-4-11(2)15-14(3)9-12-7-5-6-8-13(12)10-14/h5-8,11,15H,4,9-10H2,1-3H3.
What are the key properties of N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine?
N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine has a molecular weight of 203.33 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-2-methyl-1,3-dihydroinden-2-amine is sourced from PubChem (CID 115922520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).