C23H16F12N2O2 — CID 11592304
1,1,1,3,3,3-Hexafluoro-2-(4-(((5-methyl-2-(3-(trifluoromethyl)phenyl)oxazol-4-yl)methyl)(2,2,2-trifluoroethyl)amino)phenyl)propan-2-ol (PubChem CID 11592304) has the molecular formula C23H16F12N2O2 and a molecular weight of 580.40 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[[5-methyl-2-[3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methyl-(2,2,2-trifluoroethyl)amino]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-Hexafluoro-2-(4-(((5-methyl-2-(3-(trifluoromethyl)phenyl)oxazol-4-yl)methyl)(2,2,2-trifluoroethyl)amino)phenyl)propan-2-ol |
|---|---|
| PubChem CID | 11592304 |
| Molecular Formula | C23H16F12N2O2 |
| Molecular Weight | 580.40 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[[5-methyl-2-[3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methyl-(2,2,2-trifluoroethyl)amino]phenyl]propan-2-ol |
| SMILES | CC1=C(N=C(O1)C2=CC(=CC=C2)C(F)(F)F)CN(CC(F)(F)F)C3=CC=C(C=C3)C(C(F)(F)F)(C(F)(F)F)O |
| InChI | InChI=1S/C23H16F12N2O2/c1-12-17(36-18(39-12)13-3-2-4-15(9-13)21(27,28)29)10-37(11-19(24,25)26)16-7-5-14(6-8-16)20(38,22(30,31)32)23(33,34)35/h2-9,38H,10-11H2,1H3 |
| InChIKey | QOUARJFUWURIGY-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | 791 |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.40 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|