About 4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol
4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol (PubChem CID 115923399) has the molecular formula C10H16N2O2S
and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol.
Molecular Properties
| Compound Name | 4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol |
| PubChem CID | 115923399 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol |
| SMILES | Cc1ncsc1C(C)NC1COCC1O |
| InChI | InChI=1S/C10H16N2O2S/c1-6-10(15-5-11-6)7(2)12-8-3-14-4-9(8)13/h5,7-9,12-13H,3-4H2,1-2H3 |
| InChIKey | XOLNVBZKHMVZFB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol?
The IUPAC name of 4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol (CID 115923399) is 4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol.
What is the SMILES notation for 4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol?
The canonical SMILES for 4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol is Cc1ncsc1C(C)NC1COCC1O.
What is the InChIKey of 4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol?
The InChIKey is XOLNVBZKHMVZFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2S/c1-6-10(15-5-11-6)7(2)12-8-3-14-4-9(8)13/h5,7-9,12-13H,3-4H2,1-2H3.
What are the key properties of 4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol?
4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol has a molecular weight of 228.32 g/mol, XLogP of 0.86, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]oxolan-3-ol is sourced from PubChem (CID 115923399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).