C9H15NO3S — CID 115924075
3-methyl-4-[[(E)-3-methylsulfanylprop-2-enoyl]amino]butanoic acid (PubChem CID 115924075) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is 3-methyl-4-[[(E)-3-methylsulfanylprop-2-enoyl]amino]butanoic acid.
| Compound Name | 3-methyl-4-[[(E)-3-methylsulfanylprop-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 115924075 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 3-methyl-4-[[(E)-3-methylsulfanylprop-2-enoyl]amino]butanoic acid |
| SMILES | CS/C=C/C(=O)NCC(C)CC(=O)O |
| InChI | InChI=1S/C9H15NO3S/c1-7(5-9(12)13)6-10-8(11)3-4-14-2/h3-4,7H,5-6H2,1-2H3,(H,10,11)(H,12,13)/b4-3+ |
| InChIKey | HWIVYUYYNDTBPZ-ONEGZZNKSA-N |
| XLogP | 1.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|