C13H21NO3S2 — CID 115924398
methyl 2-[5-[(3-methylsulfinylbutylamino)methyl]thiophen-2-yl]acetate (PubChem CID 115924398) has the molecular formula C13H21NO3S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is methyl 2-[5-[(3-methylsulfinylbutylamino)methyl]thiophen-2-yl]acetate.
| Compound Name | methyl 2-[5-[(3-methylsulfinylbutylamino)methyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 115924398 |
| Molecular Formula | C13H21NO3S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | methyl 2-[5-[(3-methylsulfinylbutylamino)methyl]thiophen-2-yl]acetate |
| SMILES | COC(=O)Cc1ccc(CNCCC(C)S(C)=O)s1 |
| InChI | InChI=1S/C13H21NO3S2/c1-10(19(3)16)6-7-14-9-12-5-4-11(18-12)8-13(15)17-2/h4-5,10,14H,6-9H2,1-3H3 |
| InChIKey | JALAMXNEZPVSJM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|