C31H43N3O9 — CID 11592455
[(4E,6Z,10E)-19-(azetidin-1-yl)-13-hydroxy-10-(hydroxymethyl)-8,14-dimethoxy-4,12,16-trimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate (PubChem CID 11592455) has the molecular formula C31H43N3O9 and a molecular weight of 601.70 g/mol. Its IUPAC name is [(4E,6Z,10E)-19-(azetidin-1-yl)-13-hydroxy-10-(hydroxymethyl)-8,14-dimethoxy-4,12,16-trimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate.
| Compound Name | [(4E,6Z,10E)-19-(azetidin-1-yl)-13-hydroxy-10-(hydroxymethyl)-8,14-dimethoxy-4,12,16-trimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 11592455 |
| Molecular Formula | C31H43N3O9 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | [(4E,6Z,10E)-19-(azetidin-1-yl)-13-hydroxy-10-(hydroxymethyl)-8,14-dimethoxy-4,12,16-trimethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| SMILES | COC1/C=C\C=C(/C)C(=O)NC2=CC(=O)C(N3CCC3)=C(CC(C)CC(OC)C(O)C(C)/C=C(\CO)C1OC(N)=O)C2=O |
| InChI | InChI=1S/C31H43N3O9/c1-17-12-21-26(34-10-7-11-34)23(36)15-22(28(21)38)33-30(39)18(2)8-6-9-24(41-4)29(43-31(32)40)20(16-35)14-19(3)27(37)25(13-17)42-5/h6,8-9,14-15,17,19,24-25,27,29,35,37H,7,10-13,16H2,1-5H3,(H2,32,40)(H,33,39)/b9-6-,18-8+,20-14+ |
| InChIKey | NGXCSDUVVLERAC-FXRMULMHSA-N |
| XLogP | 1.44 |
| TPSA | 177.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|