About 6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile
6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile (PubChem CID 115925575) has the molecular formula C13H10N6O2
and a molecular weight of 282.26 g/mol. Its IUPAC name is 6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile |
| PubChem CID | 115925575 |
| Molecular Formula | C13H10N6O2 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile |
| SMILES | CCn1c(=O)[nH]c(=O)c2[nH]c(-c3ccc(C#N)cn3)nc21 |
| InChI | InChI=1S/C13H10N6O2/c1-2-19-11-9(12(20)18-13(19)21)16-10(17-11)8-4-3-7(5-14)6-15-8/h3-4,6H,2H2,1H3,(H,16,17)(H,18,20,21) |
| InChIKey | JZNGBPOKMCTCLK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile?
The IUPAC name of 6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile (CID 115925575) is 6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile.
What is the SMILES notation for 6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile?
The canonical SMILES for 6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile is CCn1c(=O)[nH]c(=O)c2[nH]c(-c3ccc(C#N)cn3)nc21.
What is the InChIKey of 6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile?
The InChIKey is JZNGBPOKMCTCLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N6O2/c1-2-19-11-9(12(20)18-13(19)21)16-10(17-11)8-4-3-7(5-14)6-15-8/h3-4,6H,2H2,1H3,(H,16,17)(H,18,20,21).
What are the key properties of 6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile?
6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile has a molecular weight of 282.26 g/mol, XLogP of 0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-ethyl-2,6-dioxo-7H-purin-8-yl)pyridine-3-carbonitrile is sourced from PubChem (CID 115925575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).