C10H17N3OS — CID 115925984
2-[3-methyl-5-(thiolan-3-ylamino)pyrazol-1-yl]ethanol (PubChem CID 115925984) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-[3-methyl-5-(thiolan-3-ylamino)pyrazol-1-yl]ethanol.
| Compound Name | 2-[3-methyl-5-(thiolan-3-ylamino)pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 115925984 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-[3-methyl-5-(thiolan-3-ylamino)pyrazol-1-yl]ethanol |
| SMILES | Cc1cc(NC2CCSC2)n(CCO)n1 |
| InChI | InChI=1S/C10H17N3OS/c1-8-6-10(13(12-8)3-4-14)11-9-2-5-15-7-9/h6,9,11,14H,2-5,7H2,1H3 |
| InChIKey | BYRDSFBFXBMLLD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |