C30H30Cl2F2N4O3S — CID 11592625
(1R,5S)-N-cyclopropyl-7-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-1,3-thiazol-5-yl]-N-[(2,3-difluorophenyl)methyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide (PubChem CID 11592625) has the molecular formula C30H30Cl2F2N4O3S and a molecular weight of 635.56 g/mol. Its IUPAC name is (1R,5S)-N-cyclopropyl-7-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-1,3-thiazol-5-yl]-N-[(2,3-difluorophenyl)methyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide.
| Compound Name | (1R,5S)-N-cyclopropyl-7-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-1,3-thiazol-5-yl]-N-[(2,3-difluorophenyl)methyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
|---|---|
| PubChem CID | 11592625 |
| Molecular Formula | C30H30Cl2F2N4O3S |
| Molecular Weight | 635.56 g/mol |
| Exact Mass | 634.14 |
| IUPAC Name | (1R,5S)-N-cyclopropyl-7-[2-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-1,3-thiazol-5-yl]-N-[(2,3-difluorophenyl)methyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
| SMILES | Cc1cc(Cl)c(OCCOc2ncc(C3=C(C(=O)N(Cc4cccc(F)c4F)C4CC4)[C@H]4CNC[C@@H](C3)N4)s2)c(Cl)c1 |
| InChI | InChI=1S/C30H30Cl2F2N4O3S/c1-16-9-21(31)28(22(32)10-16)40-7-8-41-30-36-14-25(42-30)20-11-18-12-35-13-24(37-18)26(20)29(39)38(19-5-6-19)15-17-3-2-4-23(33)27(17)34/h2-4,9-10,14,18-19,24,35,37H,5-8,11-13,15H2,1H3/t18-,24-/m1/s1 |
| InChIKey | CFGQKUKFMYWPRN-HOYKHHGWSA-N |
| XLogP | 5.77 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|