C16H18FNO2 — CID 115926974
3-cyclopentyl-4-(4-fluorophenyl)piperidine-2,6-dione (PubChem CID 115926974) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is 3-cyclopentyl-4-(4-fluorophenyl)piperidine-2,6-dione.
| Compound Name | 3-cyclopentyl-4-(4-fluorophenyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 115926974 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-cyclopentyl-4-(4-fluorophenyl)piperidine-2,6-dione |
| SMILES | O=C1CC(c2ccc(F)cc2)C(C2CCCC2)C(=O)N1 |
| InChI | InChI=1S/C16H18FNO2/c17-12-7-5-10(6-8-12)13-9-14(19)18-16(20)15(13)11-3-1-2-4-11/h5-8,11,13,15H,1-4,9H2,(H,18,19,20) |
| InChIKey | RACOPXCXHKNHQC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|