C17H25Br2NO — CID 115927255
2-[3-bromo-2-(bromomethyl)-2-cyclopentylpropyl]-4-methoxy-3,5-dimethylpyridine (PubChem CID 115927255) has the molecular formula C17H25Br2NO and a molecular weight of 419.20 g/mol. Its IUPAC name is 2-[3-bromo-2-(bromomethyl)-2-cyclopentylpropyl]-4-methoxy-3,5-dimethylpyridine.
| Compound Name | 2-[3-bromo-2-(bromomethyl)-2-cyclopentylpropyl]-4-methoxy-3,5-dimethylpyridine |
|---|---|
| PubChem CID | 115927255 |
| Molecular Formula | C17H25Br2NO |
| Molecular Weight | 419.20 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 2-[3-bromo-2-(bromomethyl)-2-cyclopentylpropyl]-4-methoxy-3,5-dimethylpyridine |
| SMILES | COc1c(C)cnc(CC(CBr)(CBr)C2CCCC2)c1C |
| InChI | InChI=1S/C17H25Br2NO/c1-12-9-20-15(13(2)16(12)21-3)8-17(10-18,11-19)14-6-4-5-7-14/h9,14H,4-8,10-11H2,1-3H3 |
| InChIKey | QCNOOIISBCOPIW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.20 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|