C14H24N2 — CID 115929102
1-N,1-N,2-trimethyl-4-N-pentan-3-ylbenzene-1,4-diamine (PubChem CID 115929102) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-N,1-N,2-trimethyl-4-N-pentan-3-ylbenzene-1,4-diamine.
| Compound Name | 1-N,1-N,2-trimethyl-4-N-pentan-3-ylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 115929102 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1-N,1-N,2-trimethyl-4-N-pentan-3-ylbenzene-1,4-diamine |
| SMILES | CCC(CC)Nc1ccc(N(C)C)c(C)c1 |
| InChI | InChI=1S/C14H24N2/c1-6-12(7-2)15-13-8-9-14(16(4)5)11(3)10-13/h8-10,12,15H,6-7H2,1-5H3 |
| InChIKey | NJQZPZGFEZDPNN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|