About [1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol
[1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol (PubChem CID 115929608) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is [1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol.
Molecular Properties
| Compound Name | [1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol |
| PubChem CID | 115929608 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | [1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol |
| SMILES | CCC1(CC)C(NC2(CO)CC2)CC1OC |
| InChI | InChI=1S/C13H25NO2/c1-4-13(5-2)10(8-11(13)16-3)14-12(9-15)6-7-12/h10-11,14-15H,4-9H2,1-3H3 |
| InChIKey | BNTOGRWOCSDMNA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol?
The IUPAC name of [1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol (CID 115929608) is [1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol.
What is the SMILES notation for [1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol?
The canonical SMILES for [1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol is CCC1(CC)C(NC2(CO)CC2)CC1OC.
What is the InChIKey of [1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol?
The InChIKey is BNTOGRWOCSDMNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-4-13(5-2)10(8-11(13)16-3)14-12(9-15)6-7-12/h10-11,14-15H,4-9H2,1-3H3.
What are the key properties of [1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol?
[1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol has a molecular weight of 227.35 g/mol, XLogP of 1.69, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2,2-diethyl-3-methoxycyclobutyl)amino]cyclopropyl]methanol is sourced from PubChem (CID 115929608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).