C14H17ClN4O — CID 115930594
3-amino-2-chloro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]benzamide (PubChem CID 115930594) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is 3-amino-2-chloro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]benzamide.
| Compound Name | 3-amino-2-chloro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 115930594 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-amino-2-chloro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]benzamide |
| SMILES | Cc1nn(C)c(C)c1CNC(=O)c1cccc(N)c1Cl |
| InChI | InChI=1S/C14H17ClN4O/c1-8-11(9(2)19(3)18-8)7-17-14(20)10-5-4-6-12(16)13(10)15/h4-6H,7,16H2,1-3H3,(H,17,20) |
| InChIKey | KTZMHUUWUZHKNG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|