2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid

C13H8BrClN2O4 — CID 115932536

IUPAC2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid
SMILESO=C(O)c1cccc([N+](=O)[O-])c1Nc1cc(Cl)ccc1Br
InChIInChI=1S/C13H8BrClN2O4/c14-9-5-4-7(15)6-10(9)16-12-8(13(18)19)2-1-3-11(12)17(20)21/h1-6,16H,(H,18,19)
InChIKeyMSKMIFORFVFWMX-UHFFFAOYSA-N
MW371.57 g/mol
LogP4.45
Rot. Bonds4

About 2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid

2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid (PubChem CID 115932536) has the molecular formula C13H8BrClN2O4 and a molecular weight of 371.57 g/mol. Its IUPAC name is 2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid.

Molecular Properties

Compound Name2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid
PubChem CID115932536
Molecular FormulaC13H8BrClN2O4
Molecular Weight371.57 g/mol
Exact Mass369.94
IUPAC Name2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid
SMILESO=C(O)c1cccc([N+](=O)[O-])c1Nc1cc(Cl)ccc1Br
InChIInChI=1S/C13H8BrClN2O4/c14-9-5-4-7(15)6-10(9)16-12-8(13(18)19)2-1-3-11(12)17(20)21/h1-6,16H,(H,18,19)
InChIKeyMSKMIFORFVFWMX-UHFFFAOYSA-N
XLogP4.45
TPSA92.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500371.57
LogP ≤ 54.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-bromo-2-(4-chloro-2-nitroanilino)benzoic acid
CID 139392425
2-(5-bromo-2-chloroanilino)-3-nitrobenzoic acid
CID 115932389
2-(4-bromo-3-fluoroanilino)-3-nitrobenzoic acid
CID 115932478
2-(2-chloro-4-methylanilino)-3-nitrobenzoic acid
CID 115932151
2-bromo-3-nitrobenzoic acid;2-chloroaniline;2-(2-chloroanilino)-3-nitrobenzoic acid;methane
CID 157398060
4-chloro-2-[(2-nitrobenzoyl)amino]benzoic acid
CID 45436116
3-(5-chloro-2-fluoroanilino)-2-nitrobenzoic acid
CID 115542164
3-(2,5-dibromoanilino)-2-nitrobenzoic acid
CID 115542274
3-nitro-2-(quinolin-8-ylamino)benzoic acid
CID 11001355
2-(3-ethylanilino)-3-nitrobenzoic acid
CID 115932132
1-bromo-4-chloro-2-nitrobenzene
CID 2794904
2-(4-bromo-2,3-dichloroanilino)-3-fluorobenzoic acid
CID 107791147

Frequently Asked Questions

What is the IUPAC name of 2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid?
The IUPAC name of 2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid (CID 115932536) is 2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid.
What is the SMILES notation for 2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid?
The canonical SMILES for 2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid is O=C(O)c1cccc([N+](=O)[O-])c1Nc1cc(Cl)ccc1Br.
What is the InChIKey of 2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid?
The InChIKey is MSKMIFORFVFWMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrClN2O4/c14-9-5-4-7(15)6-10(9)16-12-8(13(18)19)2-1-3-11(12)17(20)21/h1-6,16H,(H,18,19).
What are the key properties of 2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid?
2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid has a molecular weight of 371.57 g/mol, XLogP of 4.45, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-5-chloroanilino)-3-nitrobenzoic acid is sourced from PubChem (CID 115932536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).