C13H14N2O4S — CID 115933261
3-[(1,1-dioxothiolan-3-yl)methyl]benzimidazole-4-carboxylic acid (PubChem CID 115933261) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)methyl]benzimidazole-4-carboxylic acid.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)methyl]benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115933261 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)methyl]benzimidazole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2ncn(CC3CCS(=O)(=O)C3)c12 |
| InChI | InChI=1S/C13H14N2O4S/c16-13(17)10-2-1-3-11-12(10)15(8-14-11)6-9-4-5-20(18,19)7-9/h1-3,8-9H,4-7H2,(H,16,17) |
| InChIKey | WULHPIHWUPBCOG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |