C14H17N3O2S — CID 115934370
ethyl 3-amino-2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]benzoate (PubChem CID 115934370) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is ethyl 3-amino-2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]benzoate.
| Compound Name | ethyl 3-amino-2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 115934370 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | ethyl 3-amino-2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]benzoate |
| SMILES | CCOC(=O)c1cccc(N)c1Nc1nc(C)c(C)s1 |
| InChI | InChI=1S/C14H17N3O2S/c1-4-19-13(18)10-6-5-7-11(15)12(10)17-14-16-8(2)9(3)20-14/h5-7H,4,15H2,1-3H3,(H,16,17) |
| InChIKey | TXPJVDDSKAXQHE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|