C5H11NO3 — CID 11593442
(1S,2S,3R,4R)-4-aminocyclopentane-1,2,3-triol (PubChem CID 11593442) has the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. Its IUPAC name is (1S,2S,3R,4R)-4-aminocyclopentane-1,2,3-triol.
| Compound Name | (1S,2S,3R,4R)-4-aminocyclopentane-1,2,3-triol |
|---|---|
| PubChem CID | 11593442 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | (1S,2S,3R,4R)-4-aminocyclopentane-1,2,3-triol |
| SMILES | N[C@@H]1C[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H11NO3/c6-2-1-3(7)5(9)4(2)8/h2-5,7-9H,1,6H2/t2-,3+,4-,5+/m1/s1 |
| InChIKey | UUKWSEIZIMUXPU-LECHCGJUSA-N |
| XLogP | -2.20 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |