C7H12O4 — CID 11593476
(2R,3R,4R,6S)-2,3,4-trihydroxy-6-methylcyclohexan-1-one (PubChem CID 11593476) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is (2R,3R,4R,6S)-2,3,4-trihydroxy-6-methylcyclohexan-1-one.
| Compound Name | (2R,3R,4R,6S)-2,3,4-trihydroxy-6-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 11593476 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (2R,3R,4R,6S)-2,3,4-trihydroxy-6-methylcyclohexan-1-one |
| SMILES | C[C@H]1C[C@@H](O)[C@@H](O)[C@@H](O)C1=O |
| InChI | InChI=1S/C7H12O4/c1-3-2-4(8)6(10)7(11)5(3)9/h3-4,6-8,10-11H,2H2,1H3/t3-,4+,6+,7-/m0/s1 |
| InChIKey | FQFXYFNHFVFHPV-HPQVQDLLSA-N |
| XLogP | -1.32 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |