About 5,6-dihydroxy-3H-1,3-benzoxazol-2-one
5,6-dihydroxy-3H-1,3-benzoxazol-2-one (PubChem CID 11593497) has the molecular formula C7H5NO4
and a molecular weight of 167.12 g/mol. Its IUPAC name is 5,6-dihydroxy-3H-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 5,6-dihydroxy-3H-1,3-benzoxazol-2-one |
| PubChem CID | 11593497 |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 5,6-dihydroxy-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(O)c(O)cc2o1 |
| InChI | InChI=1S/C7H5NO4/c9-4-1-3-6(2-5(4)10)12-7(11)8-3/h1-2,9-10H,(H,8,11) |
| InChIKey | WBIBLBWGBQVZSO-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dihydroxy-3H-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydroxy-3H-1,3-benzoxazol-2-one?
The IUPAC name of 5,6-dihydroxy-3H-1,3-benzoxazol-2-one (CID 11593497) is 5,6-dihydroxy-3H-1,3-benzoxazol-2-one.
What is the SMILES notation for 5,6-dihydroxy-3H-1,3-benzoxazol-2-one?
The canonical SMILES for 5,6-dihydroxy-3H-1,3-benzoxazol-2-one is O=c1[nH]c2cc(O)c(O)cc2o1.
What is the InChIKey of 5,6-dihydroxy-3H-1,3-benzoxazol-2-one?
The InChIKey is WBIBLBWGBQVZSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO4/c9-4-1-3-6(2-5(4)10)12-7(11)8-3/h1-2,9-10H,(H,8,11).
What are the key properties of 5,6-dihydroxy-3H-1,3-benzoxazol-2-one?
5,6-dihydroxy-3H-1,3-benzoxazol-2-one has a molecular weight of 167.12 g/mol, XLogP of 0.53, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydroxy-3H-1,3-benzoxazol-2-one is sourced from PubChem (CID 11593497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).