C8H8O4 — CID 11593500
(1aS,2R,6R,6aR)-1a,2,6,6a-tetrahydrooxireno[2,3-f][2]benzofuran-2,6-diol (PubChem CID 11593500) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is (1aS,2R,6R,6aR)-1a,2,6,6a-tetrahydrooxireno[2,3-f][2]benzofuran-2,6-diol.
| Compound Name | (1aS,2R,6R,6aR)-1a,2,6,6a-tetrahydrooxireno[2,3-f][2]benzofuran-2,6-diol |
|---|---|
| PubChem CID | 11593500 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (1aS,2R,6R,6aR)-1a,2,6,6a-tetrahydrooxireno[2,3-f][2]benzofuran-2,6-diol |
| SMILES | O[C@@H]1c2cocc2[C@@H](O)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C8H8O4/c9-5-3-1-11-2-4(3)6(10)8-7(5)12-8/h1-2,5-10H/t5-,6-,7-,8+/m1/s1 |
| InChIKey | MKXNJYOXVYLCPJ-XUTVFYLZSA-N |
| XLogP | 0.13 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|