About 9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline
9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline (PubChem CID 11593564) has the molecular formula C11H9FN2
and a molecular weight of 188.21 g/mol. Its IUPAC name is 9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline.
Molecular Properties
| Compound Name | 9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline |
| PubChem CID | 11593564 |
| Molecular Formula | C11H9FN2 |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline |
| SMILES | Fc1ccc2c(c1)-c1nccn1CC2 |
| InChI | InChI=1S/C11H9FN2/c12-9-2-1-8-3-5-14-6-4-13-11(14)10(8)7-9/h1-2,4,6-7H,3,5H2 |
| InChIKey | FPLRMVIYMYTART-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline?
The IUPAC name of 9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline (CID 11593564) is 9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline.
What is the SMILES notation for 9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline?
The canonical SMILES for 9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline is Fc1ccc2c(c1)-c1nccn1CC2.
What is the InChIKey of 9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline?
The InChIKey is FPLRMVIYMYTART-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2/c12-9-2-1-8-3-5-14-6-4-13-11(14)10(8)7-9/h1-2,4,6-7H,3,5H2.
What are the key properties of 9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline?
9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline has a molecular weight of 188.21 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-5,6-dihydroimidazo[2,1-a]isoquinoline is sourced from PubChem (CID 11593564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).