C13H8Cl3N5 — CID 115936156
2-chloro-3-[1-(3,4-dichlorophenyl)tetrazol-5-yl]aniline (PubChem CID 115936156) has the molecular formula C13H8Cl3N5 and a molecular weight of 340.60 g/mol. Its IUPAC name is 2-chloro-3-[1-(3,4-dichlorophenyl)tetrazol-5-yl]aniline.
| Compound Name | 2-chloro-3-[1-(3,4-dichlorophenyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 115936156 |
| Molecular Formula | C13H8Cl3N5 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 2-chloro-3-[1-(3,4-dichlorophenyl)tetrazol-5-yl]aniline |
| SMILES | Nc1cccc(-c2nnnn2-c2ccc(Cl)c(Cl)c2)c1Cl |
| InChI | InChI=1S/C13H8Cl3N5/c14-9-5-4-7(6-10(9)15)21-13(18-19-20-21)8-2-1-3-11(17)12(8)16/h1-6H,17H2 |
| InChIKey | WQTAULUGYFGRNF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|