C13H18ClN5O — CID 115936270
2-chloro-3-[1-(1-methoxypentan-2-yl)tetrazol-5-yl]aniline (PubChem CID 115936270) has the molecular formula C13H18ClN5O and a molecular weight of 295.77 g/mol. Its IUPAC name is 2-chloro-3-[1-(1-methoxypentan-2-yl)tetrazol-5-yl]aniline.
| Compound Name | 2-chloro-3-[1-(1-methoxypentan-2-yl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 115936270 |
| Molecular Formula | C13H18ClN5O |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-chloro-3-[1-(1-methoxypentan-2-yl)tetrazol-5-yl]aniline |
| SMILES | CCCC(COC)n1nnnc1-c1cccc(N)c1Cl |
| InChI | InChI=1S/C13H18ClN5O/c1-3-5-9(8-20-2)19-13(16-17-18-19)10-6-4-7-11(15)12(10)14/h4,6-7,9H,3,5,8,15H2,1-2H3 |
| InChIKey | CMEMKEJILTWGMI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|