About azanium 1,1-dioxo-1,2-benzothiazol-3-olate
azanium 1,1-dioxo-1,2-benzothiazol-3-olate (PubChem CID 11593632) has the molecular formula C7H8N2O3S
and a molecular weight of 200.22 g/mol. Its IUPAC name is azanium 1,1-dioxo-1,2-benzothiazol-3-olate.
Molecular Properties
| Compound Name | azanium 1,1-dioxo-1,2-benzothiazol-3-olate |
| PubChem CID | 11593632 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | azanium 1,1-dioxo-1,2-benzothiazol-3-olate |
| SMILES | O=S1(=O)N=C([O-])c2ccccc21.[NH4+] |
| InChI | InChI=1S/C7H5NO3S.H3N/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;/h1-4H,(H,8,9);1H3 |
| InChIKey | XTPLQANXHDDXIH-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azanium 1,1-dioxo-1,2-benzothiazol-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 1,1-dioxo-1,2-benzothiazol-3-olate?
The IUPAC name of azanium 1,1-dioxo-1,2-benzothiazol-3-olate (CID 11593632) is azanium 1,1-dioxo-1,2-benzothiazol-3-olate.
What is the SMILES notation for azanium 1,1-dioxo-1,2-benzothiazol-3-olate?
The canonical SMILES for azanium 1,1-dioxo-1,2-benzothiazol-3-olate is O=S1(=O)N=C([O-])c2ccccc21.[NH4+].
What is the InChIKey of azanium 1,1-dioxo-1,2-benzothiazol-3-olate?
The InChIKey is XTPLQANXHDDXIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3S.H3N/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;/h1-4H,(H,8,9);1H3.
What are the key properties of azanium 1,1-dioxo-1,2-benzothiazol-3-olate?
azanium 1,1-dioxo-1,2-benzothiazol-3-olate has a molecular weight of 200.22 g/mol, XLogP of -0.13, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 1,1-dioxo-1,2-benzothiazol-3-olate is sourced from PubChem (CID 11593632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).